C11H11Cl2N5OS — CID 61346085
N-(4-amino-2,6-dichlorophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 61346085) has the molecular formula C11H11Cl2N5OS and a molecular weight of 332.22 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 61346085 |
| Molecular Formula | C11H11Cl2N5OS |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | Cc1nc(SCC(=O)Nc2c(Cl)cc(N)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C11H11Cl2N5OS/c1-5-15-11(18-17-5)20-4-9(19)16-10-7(12)2-6(14)3-8(10)13/h2-3H,4,14H2,1H3,(H,16,19)(H,15,17,18) |
| InChIKey | YWLFEHMRRDUOHL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|