C7H11NOS2 — CID 115742698
2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propan-1-ol (PubChem CID 115742698) has the molecular formula C7H11NOS2 and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propan-1-ol.
| Compound Name | 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 115742698 |
| Molecular Formula | C7H11NOS2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propan-1-ol |
| SMILES | Cc1csc(SC(C)CO)n1 |
| InChI | InChI=1S/C7H11NOS2/c1-5-4-10-7(8-5)11-6(2)3-9/h4,6,9H,3H2,1-2H3 |
| InChIKey | XUJYIPQXDFZIOR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |