C7H10BrNOS2 — CID 79399901
3-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]butan-1-ol (PubChem CID 79399901) has the molecular formula C7H10BrNOS2 and a molecular weight of 268.20 g/mol. Its IUPAC name is 3-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]butan-1-ol.
| Compound Name | 3-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]butan-1-ol |
|---|---|
| PubChem CID | 79399901 |
| Molecular Formula | C7H10BrNOS2 |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 266.94 |
| IUPAC Name | 3-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]butan-1-ol |
| SMILES | CC(CCO)Sc1nc(Br)cs1 |
| InChI | InChI=1S/C7H10BrNOS2/c1-5(2-3-10)12-7-9-6(8)4-11-7/h4-5,10H,2-3H2,1H3 |
| InChIKey | BRRRJSAEUZHGGM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |