C7H10N2O3S2 — CID 102771198
3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol (PubChem CID 102771198) has the molecular formula C7H10N2O3S2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol.
| Compound Name | 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol |
|---|---|
| PubChem CID | 102771198 |
| Molecular Formula | C7H10N2O3S2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol |
| SMILES | CC(CCO)Sc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C7H10N2O3S2/c1-5(2-3-10)13-7-8-4-6(14-7)9(11)12/h4-5,10H,2-3H2,1H3 |
| InChIKey | BXTLIUTZWRIFQY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|