C18H15NO4S2 — CID 18967042
2-methyl-3-[(4-phenyl-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid (PubChem CID 18967042) has the molecular formula C18H15NO4S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-methyl-3-[(4-phenyl-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid.
| Compound Name | 2-methyl-3-[(4-phenyl-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid |
|---|---|
| PubChem CID | 18967042 |
| Molecular Formula | C18H15NO4S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-methyl-3-[(4-phenyl-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid |
| SMILES | CC(C(=O)O)C(Sc1nc2c(-c3ccccc3)cccc2s1)C(=O)O |
| InChI | InChI=1S/C18H15NO4S2/c1-10(16(20)21)15(17(22)23)25-18-19-14-12(8-5-9-13(14)24-18)11-6-3-2-4-7-11/h2-10,15H,1H3,(H,20,21)(H,22,23) |
| InChIKey | VYRCIDRUCVKEMJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |