C23H24N2O4S4 — CID 160953355
5-(1,3-benzothiazol-2-ylsulfanyl)pentanoic acid;2-[(4-methyl-1,3-benzothiazol-2-yl)sulfanyl]propanoic acid (PubChem CID 160953355) has the molecular formula C23H24N2O4S4 and a molecular weight of 520.72 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-ylsulfanyl)pentanoic acid;2-[(4-methyl-1,3-benzothiazol-2-yl)sulfanyl]propanoic acid.
| Compound Name | 5-(1,3-benzothiazol-2-ylsulfanyl)pentanoic acid;2-[(4-methyl-1,3-benzothiazol-2-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 160953355 |
| Molecular Formula | C23H24N2O4S4 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | 5-(1,3-benzothiazol-2-ylsulfanyl)pentanoic acid;2-[(4-methyl-1,3-benzothiazol-2-yl)sulfanyl]propanoic acid |
| SMILES | Cc1cccc2sc(SC(C)C(=O)O)nc12.O=C(O)CCCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H13NO2S2.C11H11NO2S2/c14-11(15)7-3-4-8-16-12-13-9-5-1-2-6-10(9)17-12;1-6-4-3-5-8-9(6)12-11(16-8)15-7(2)10(13)14/h1-2,5-6H,3-4,7-8H2,(H,14,15);3-5,7H,1-2H3,(H,13,14) |
| InChIKey | SWBBBPMYKSYQBH-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|