C12H8BrCl2FN2 — CID 107571476
4-bromo-1-N-(3,5-dichloro-4-fluorophenyl)benzene-1,2-diamine (PubChem CID 107571476) has the molecular formula C12H8BrCl2FN2 and a molecular weight of 350.02 g/mol. Its IUPAC name is 4-bromo-1-N-(3,5-dichloro-4-fluorophenyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-(3,5-dichloro-4-fluorophenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 107571476 |
| Molecular Formula | C12H8BrCl2FN2 |
| Molecular Weight | 350.02 g/mol |
| Exact Mass | 347.92 |
| IUPAC Name | 4-bromo-1-N-(3,5-dichloro-4-fluorophenyl)benzene-1,2-diamine |
| SMILES | Nc1cc(Br)ccc1Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C12H8BrCl2FN2/c13-6-1-2-11(10(17)3-6)18-7-4-8(14)12(16)9(15)5-7/h1-5,18H,17H2 |
| InChIKey | OWETUPJLLLRSJO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.02 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|