C8H4ClF3O2 — CID 97109372
(3S)-3-chloro-2,2,3-trifluoro-1,4-benzodioxine (PubChem CID 97109372) has the molecular formula C8H4ClF3O2 and a molecular weight of 224.57 g/mol. Its IUPAC name is (3S)-3-chloro-2,2,3-trifluoro-1,4-benzodioxine.
| Compound Name | (3S)-3-chloro-2,2,3-trifluoro-1,4-benzodioxine |
|---|---|
| PubChem CID | 97109372 |
| Molecular Formula | C8H4ClF3O2 |
| Molecular Weight | 224.57 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | (3S)-3-chloro-2,2,3-trifluoro-1,4-benzodioxine |
| SMILES | FC1(F)Oc2ccccc2O[C@@]1(F)Cl |
| InChI | InChI=1S/C8H4ClF3O2/c9-7(10)8(11,12)14-6-4-2-1-3-5(6)13-7/h1-4H/t7-/m1/s1 |
| InChIKey | HISYYZRZIJMXSF-SSDOTTSWSA-N |
| XLogP | 2.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|