C9H6ClF3O2 — CID 142113644
2-chloro-2,3,3-trifluoro-5-methyl-1,4-benzodioxine (PubChem CID 142113644) has the molecular formula C9H6ClF3O2 and a molecular weight of 238.59 g/mol. Its IUPAC name is 2-chloro-2,3,3-trifluoro-5-methyl-1,4-benzodioxine.
| Compound Name | 2-chloro-2,3,3-trifluoro-5-methyl-1,4-benzodioxine |
|---|---|
| PubChem CID | 142113644 |
| Molecular Formula | C9H6ClF3O2 |
| Molecular Weight | 238.59 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 2-chloro-2,3,3-trifluoro-5-methyl-1,4-benzodioxine |
| SMILES | Cc1cccc2c1OC(F)(F)C(F)(Cl)O2 |
| InChI | InChI=1S/C9H6ClF3O2/c1-5-3-2-4-6-7(5)15-9(12,13)8(10,11)14-6/h2-4H,1H3 |
| InChIKey | SXRBHNMEDKAIIS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|