C10H15O2P — CID 162737924
ethane;(4-methyl-1,3-benzodioxol-2-yl)phosphane (PubChem CID 162737924) has the molecular formula C10H15O2P and a molecular weight of 198.20 g/mol. Its IUPAC name is ethane;(4-methyl-1,3-benzodioxol-2-yl)phosphane.
| Compound Name | ethane;(4-methyl-1,3-benzodioxol-2-yl)phosphane |
|---|---|
| PubChem CID | 162737924 |
| Molecular Formula | C10H15O2P |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | ethane;(4-methyl-1,3-benzodioxol-2-yl)phosphane |
| SMILES | CC.Cc1cccc2c1OC(P)O2 |
| InChI | InChI=1S/C8H9O2P.C2H6/c1-5-3-2-4-6-7(5)10-8(11)9-6;1-2/h2-4,8H,11H2,1H3;1-2H3 |
| InChIKey | JBQBCKAXENTCNX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|