C14H16O2 — CID 91207856
deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin (PubChem CID 91207856) has the molecular formula C14H16O2 and a molecular weight of 217.29 g/mol. Its IUPAC name is deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin.
| Compound Name | deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin |
|---|---|
| PubChem CID | 91207856 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin |
| SMILES | Cc1cccc2c1OC1C=CC=CC1O2.[2H]C |
| InChI | InChI=1S/C13H12O2.CH4/c1-9-5-4-8-12-13(9)15-11-7-3-2-6-10(11)14-12;/h2-8,10-11H,1H3;1H4/i;1D |
| InChIKey | YUFMJRAJXHTDBB-DIYDOPDJSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |