About deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin
deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin (PubChem CID 91207856) has the molecular formula C14H16O2
and a molecular weight of 217.29 g/mol. Its IUPAC name is deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin.
Molecular Properties
| Compound Name | deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin |
| PubChem CID | 91207856 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin |
| SMILES | Cc1cccc2c1OC1C=CC=CC1O2.[2H]C |
| InChI | InChI=1S/C13H12O2.CH4/c1-9-5-4-8-12-13(9)15-11-7-3-2-6-10(11)14-12;/h2-8,10-11H,1H3;1H4/i;1D |
| InChIKey | YUFMJRAJXHTDBB-DIYDOPDJSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin?
The IUPAC name of deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin (CID 91207856) is deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin.
What is the SMILES notation for deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin?
The canonical SMILES for deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin is Cc1cccc2c1OC1C=CC=CC1O2.[2H]C.
What is the InChIKey of deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin?
The InChIKey is YUFMJRAJXHTDBB-DIYDOPDJSA-N. The full InChI is InChI=1S/C13H12O2.CH4/c1-9-5-4-8-12-13(9)15-11-7-3-2-6-10(11)14-12;/h2-8,10-11H,1H3;1H4/i;1D.
What are the key properties of deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin?
deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin has a molecular weight of 217.29 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for deuteriomethane;6-methyl-4a,10a-dihydrodibenzo-p-dioxin is sourced from PubChem (CID 91207856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).