C13H12O — CID 146532547
(4aR,9bR)-8-methyl-4a,9b-dihydrodibenzofuran (PubChem CID 146532547) has the molecular formula C13H12O and a molecular weight of 184.24 g/mol. Its IUPAC name is (4aR,9bR)-8-methyl-4a,9b-dihydrodibenzofuran.
| Compound Name | (4aR,9bR)-8-methyl-4a,9b-dihydrodibenzofuran |
|---|---|
| PubChem CID | 146532547 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | (4aR,9bR)-8-methyl-4a,9b-dihydrodibenzofuran |
| SMILES | Cc1ccc2c(c1)[C@H]1C=CC=C[C@H]1O2 |
| InChI | InChI=1S/C13H12O/c1-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13/h2-8,10,12H,1H3/t10-,12-/m1/s1 |
| InChIKey | SUWUMPWYDZMPLR-ZYHUDNBSSA-N |
| XLogP | 2.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |