C17H12ClNO — CID 146294855
2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine (PubChem CID 146294855) has the molecular formula C17H12ClNO and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine.
| Compound Name | 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine |
|---|---|
| PubChem CID | 146294855 |
| Molecular Formula | C17H12ClNO |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine |
| SMILES | Clc1cccnc1-c1ccc2c(c1)[C@@H]1C=CC=CC1O2 |
| InChI | InChI=1S/C17H12ClNO/c18-14-5-3-9-19-17(14)11-7-8-16-13(10-11)12-4-1-2-6-15(12)20-16/h1-10,12,15H/t12-,15?/m0/s1 |
| InChIKey | XWXGVVRBWKWBAU-SFVWDYPZSA-N |
| XLogP | 4.37 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |