About 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine
2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine (PubChem CID 146294855) has the molecular formula C17H12ClNO
and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine.
Molecular Properties
| Compound Name | 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine |
| PubChem CID | 146294855 |
| Molecular Formula | C17H12ClNO |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine |
| SMILES | Clc1cccnc1-c1ccc2c(c1)[C@@H]1C=CC=CC1O2 |
| InChI | InChI=1S/C17H12ClNO/c18-14-5-3-9-19-17(14)11-7-8-16-13(10-11)12-4-1-2-6-15(12)20-16/h1-10,12,15H/t12-,15?/m0/s1 |
| InChIKey | XWXGVVRBWKWBAU-SFVWDYPZSA-N |
| XLogP | 4.37 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine?
The IUPAC name of 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine (CID 146294855) is 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine.
What is the SMILES notation for 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine?
The canonical SMILES for 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine is Clc1cccnc1-c1ccc2c(c1)[C@@H]1C=CC=CC1O2.
What is the InChIKey of 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine?
The InChIKey is XWXGVVRBWKWBAU-SFVWDYPZSA-N. The full InChI is InChI=1S/C17H12ClNO/c18-14-5-3-9-19-17(14)11-7-8-16-13(10-11)12-4-1-2-6-15(12)20-16/h1-10,12,15H/t12-,15?/m0/s1.
What are the key properties of 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine?
2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine has a molecular weight of 281.74 g/mol, XLogP of 4.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(9aS)-5a,9a-dihydrodibenzofuran-2-yl]-3-chloropyridine is sourced from PubChem (CID 146294855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).