C10H3ClF6N2O2 — CID 14011580
6-chloro-6,7,7-trifluoro-2-(trifluoromethyl)-1H-[1,4]dioxino[2,3-f]benzimidazole (PubChem CID 14011580) has the molecular formula C10H3ClF6N2O2 and a molecular weight of 332.59 g/mol. Its IUPAC name is 6-chloro-6,7,7-trifluoro-2-(trifluoromethyl)-1H-[1,4]dioxino[2,3-f]benzimidazole.
| Compound Name | 6-chloro-6,7,7-trifluoro-2-(trifluoromethyl)-1H-[1,4]dioxino[2,3-f]benzimidazole |
|---|---|
| PubChem CID | 14011580 |
| Molecular Formula | C10H3ClF6N2O2 |
| Molecular Weight | 332.59 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 6-chloro-6,7,7-trifluoro-2-(trifluoromethyl)-1H-[1,4]dioxino[2,3-f]benzimidazole |
| SMILES | FC(F)(F)c1nc2cc3c(cc2[nH]1)OC(F)(F)C(F)(Cl)O3 |
| InChI | InChI=1S/C10H3ClF6N2O2/c11-9(15)10(16,17)21-6-2-4-3(1-5(6)20-9)18-7(19-4)8(12,13)14/h1-2H,(H,18,19) |
| InChIKey | INCOJZGIYZTANZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|