C14H10F3NO4S — CID 888461
N-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]benzenesulfonamide (PubChem CID 888461) has the molecular formula C14H10F3NO4S and a molecular weight of 345.30 g/mol. Its IUPAC name is N-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]benzenesulfonamide.
| Compound Name | N-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 888461 |
| Molecular Formula | C14H10F3NO4S |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | N-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1(C(F)(F)F)Oc2ccccc2O1)c1ccccc1 |
| InChI | InChI=1S/C14H10F3NO4S/c15-13(16,17)14(21-11-8-4-5-9-12(11)22-14)18-23(19,20)10-6-2-1-3-7-10/h1-9,18H |
| InChIKey | BFENQIJCRWDWBN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |