C21H27F3N2O3 — CID 2160656
1,1-dicyclohexyl-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea (PubChem CID 2160656) has the molecular formula C21H27F3N2O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is 1,1-dicyclohexyl-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea.
| Compound Name | 1,1-dicyclohexyl-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
|---|---|
| PubChem CID | 2160656 |
| Molecular Formula | C21H27F3N2O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1,1-dicyclohexyl-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
| SMILES | O=C(NC1(C(F)(F)F)Oc2ccccc2O1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C21H27F3N2O3/c22-20(23,24)21(28-17-13-7-8-14-18(17)29-21)25-19(27)26(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h7-8,13-16H,1-6,9-12H2,(H,25,27) |
| InChIKey | IELCIEYOGRWCOY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |