C22H17F3N2O3 — CID 2160647
1-benzhydryl-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea (PubChem CID 2160647) has the molecular formula C22H17F3N2O3 and a molecular weight of 414.38 g/mol. Its IUPAC name is 1-benzhydryl-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea.
| Compound Name | 1-benzhydryl-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
|---|---|
| PubChem CID | 2160647 |
| Molecular Formula | C22H17F3N2O3 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-benzhydryl-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)NC1(C(F)(F)F)Oc2ccccc2O1 |
| InChI | InChI=1S/C22H17F3N2O3/c23-21(24,25)22(29-17-13-7-8-14-18(17)30-22)27-20(28)26-19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19H,(H2,26,27,28) |
| InChIKey | OHOKBGLOUVXUBX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |