C15H11F3N2O3 — CID 756384
1-phenyl-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea (PubChem CID 756384) has the molecular formula C15H11F3N2O3 and a molecular weight of 324.26 g/mol. Its IUPAC name is 1-phenyl-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea.
| Compound Name | 1-phenyl-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
|---|---|
| PubChem CID | 756384 |
| Molecular Formula | C15H11F3N2O3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 1-phenyl-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
| SMILES | O=C(Nc1ccccc1)NC1(C(F)(F)F)Oc2ccccc2O1 |
| InChI | InChI=1S/C15H11F3N2O3/c16-14(17,18)15(22-11-8-4-5-9-12(11)23-15)20-13(21)19-10-6-2-1-3-7-10/h1-9H,(H2,19,20,21) |
| InChIKey | ZLGDXHJGPGTBKV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |