C15H9F4N3O5 — CID 2051828
1-(4-fluoro-3-nitrophenyl)-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea (PubChem CID 2051828) has the molecular formula C15H9F4N3O5 and a molecular weight of 387.25 g/mol. Its IUPAC name is 1-(4-fluoro-3-nitrophenyl)-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea.
| Compound Name | 1-(4-fluoro-3-nitrophenyl)-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
|---|---|
| PubChem CID | 2051828 |
| Molecular Formula | C15H9F4N3O5 |
| Molecular Weight | 387.25 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 1-(4-fluoro-3-nitrophenyl)-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
| SMILES | O=C(Nc1ccc(F)c([N+](=O)[O-])c1)NC1(C(F)(F)F)Oc2ccccc2O1 |
| InChI | InChI=1S/C15H9F4N3O5/c16-9-6-5-8(7-10(9)22(24)25)20-13(23)21-15(14(17,18)19)26-11-3-1-2-4-12(11)27-15/h1-7H,(H2,20,21,23) |
| InChIKey | SNOZNVHRGPFIFU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|