C15H8ClF4N3O5 — CID 5211577
1-[5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]-3-(4-fluoro-2-nitrophenyl)urea (PubChem CID 5211577) has the molecular formula C15H8ClF4N3O5 and a molecular weight of 421.69 g/mol. Its IUPAC name is 1-[5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]-3-(4-fluoro-2-nitrophenyl)urea.
| Compound Name | 1-[5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]-3-(4-fluoro-2-nitrophenyl)urea |
|---|---|
| PubChem CID | 5211577 |
| Molecular Formula | C15H8ClF4N3O5 |
| Molecular Weight | 421.69 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 1-[5-chloro-2-(trifluoromethyl)-1,3-benzodioxol-2-yl]-3-(4-fluoro-2-nitrophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1[N+](=O)[O-])NC1(C(F)(F)F)Oc2ccc(Cl)cc2O1 |
| InChI | InChI=1S/C15H8ClF4N3O5/c16-7-1-4-11-12(5-7)28-15(27-11,14(18,19)20)22-13(24)21-9-3-2-8(17)6-10(9)23(25)26/h1-6H,(H2,21,22,24) |
| InChIKey | SGWTVSKHSGJZLY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.69 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|