About 1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea
1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea (PubChem CID 756402) has the molecular formula C13H16F3N3O3
and a molecular weight of 319.28 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea.
Molecular Properties
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
| PubChem CID | 756402 |
| Molecular Formula | C13H16F3N3O3 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea |
| SMILES | CN(C)CCNC(=O)NC1(C(F)(F)F)Oc2ccccc2O1 |
| InChI | InChI=1S/C13H16F3N3O3/c1-19(2)8-7-17-11(20)18-13(12(14,15)16)21-9-5-3-4-6-10(9)22-13/h3-6H,7-8H2,1-2H3,(H2,17,18,20) |
| InChIKey | ABBFRYRALCCFJO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea?
The IUPAC name of 1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea (CID 756402) is 1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea.
What is the SMILES notation for 1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea?
The canonical SMILES for 1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea is CN(C)CCNC(=O)NC1(C(F)(F)F)Oc2ccccc2O1.
What is the InChIKey of 1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea?
The InChIKey is ABBFRYRALCCFJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3N3O3/c1-19(2)8-7-17-11(20)18-13(12(14,15)16)21-9-5-3-4-6-10(9)22-13/h3-6H,7-8H2,1-2H3,(H2,17,18,20).
What are the key properties of 1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea?
1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea has a molecular weight of 319.28 g/mol, XLogP of 1.53, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(dimethylamino)ethyl]-3-[2-(trifluoromethyl)-1,3-benzodioxol-2-yl]urea is sourced from PubChem (CID 756402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).