C15H9Cl5N2O3 — CID 56687939
1-[5,6-dichloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]-3-phenylurea (PubChem CID 56687939) has the molecular formula C15H9Cl5N2O3 and a molecular weight of 442.51 g/mol. Its IUPAC name is 1-[5,6-dichloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]-3-phenylurea.
| Compound Name | 1-[5,6-dichloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 56687939 |
| Molecular Formula | C15H9Cl5N2O3 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 439.91 |
| IUPAC Name | 1-[5,6-dichloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)NC1(C(Cl)(Cl)Cl)Oc2cc(Cl)c(Cl)cc2O1 |
| InChI | InChI=1S/C15H9Cl5N2O3/c16-9-6-11-12(7-10(9)17)25-15(24-11,14(18,19)20)22-13(23)21-8-4-2-1-3-5-8/h1-7H,(H2,21,22,23) |
| InChIKey | SOIBPYMVOAOPHQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|