C15H14Cl3N3O — CID 1381267
1-[(1R)-1-anilino-2,2,2-trichloroethyl]-3-phenylurea (PubChem CID 1381267) has the molecular formula C15H14Cl3N3O and a molecular weight of 358.66 g/mol. Its IUPAC name is 1-[(1R)-1-anilino-2,2,2-trichloroethyl]-3-phenylurea.
| Compound Name | 1-[(1R)-1-anilino-2,2,2-trichloroethyl]-3-phenylurea |
|---|---|
| PubChem CID | 1381267 |
| Molecular Formula | C15H14Cl3N3O |
| Molecular Weight | 358.66 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 1-[(1R)-1-anilino-2,2,2-trichloroethyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N[C@@H](Nc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H14Cl3N3O/c16-15(17,18)13(19-11-7-3-1-4-8-11)21-14(22)20-12-9-5-2-6-10-12/h1-10,13,19H,(H2,20,21,22)/t13-/m1/s1 |
| InChIKey | BFWJCNIFRZMZRO-CYBMUJFWSA-N |
| XLogP | 4.62 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.66 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|