C11H13Cl3N2O2 — CID 901830
methyl N-[(1S)-2,2,2-trichloro-1-(4-methylanilino)ethyl]carbamate (PubChem CID 901830) has the molecular formula C11H13Cl3N2O2 and a molecular weight of 311.60 g/mol. Its IUPAC name is methyl N-[(1S)-2,2,2-trichloro-1-(4-methylanilino)ethyl]carbamate.
| Compound Name | methyl N-[(1S)-2,2,2-trichloro-1-(4-methylanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 901830 |
| Molecular Formula | C11H13Cl3N2O2 |
| Molecular Weight | 311.60 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | methyl N-[(1S)-2,2,2-trichloro-1-(4-methylanilino)ethyl]carbamate |
| SMILES | COC(=O)N[C@H](Nc1ccc(C)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H13Cl3N2O2/c1-7-3-5-8(6-4-7)15-9(11(12,13)14)16-10(17)18-2/h3-6,9,15H,1-2H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | FFKVQADMJIDFLX-VIFPVBQESA-N |
| XLogP | 3.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.60 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|