C14H19Cl3N2O — CID 92846944
N-[(1R)-1-(tert-butylamino)-2,2,2-trichloroethyl]-4-methylbenzamide (PubChem CID 92846944) has the molecular formula C14H19Cl3N2O and a molecular weight of 337.68 g/mol. Its IUPAC name is N-[(1R)-1-(tert-butylamino)-2,2,2-trichloroethyl]-4-methylbenzamide.
| Compound Name | N-[(1R)-1-(tert-butylamino)-2,2,2-trichloroethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 92846944 |
| Molecular Formula | C14H19Cl3N2O |
| Molecular Weight | 337.68 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-[(1R)-1-(tert-butylamino)-2,2,2-trichloroethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](NC(C)(C)C)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H19Cl3N2O/c1-9-5-7-10(8-6-9)11(20)18-12(14(15,16)17)19-13(2,3)4/h5-8,12,19H,1-4H3,(H,18,20)/t12-/m0/s1 |
| InChIKey | OOCHLLKIPZMYMU-LBPRGKRZSA-N |
| XLogP | 3.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.68 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|