C17H17Cl3N2O2 — CID 3092691
2-methoxy-N-[2,2,2-trichloro-1-(3-methylanilino)ethyl]benzamide (PubChem CID 3092691) has the molecular formula C17H17Cl3N2O2 and a molecular weight of 387.69 g/mol. Its IUPAC name is 2-methoxy-N-[2,2,2-trichloro-1-(3-methylanilino)ethyl]benzamide.
| Compound Name | 2-methoxy-N-[2,2,2-trichloro-1-(3-methylanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 3092691 |
| Molecular Formula | C17H17Cl3N2O2 |
| Molecular Weight | 387.69 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 2-methoxy-N-[2,2,2-trichloro-1-(3-methylanilino)ethyl]benzamide |
| SMILES | COc1ccccc1C(=O)NC(Nc1cccc(C)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H17Cl3N2O2/c1-11-6-5-7-12(10-11)21-16(17(18,19)20)22-15(23)13-8-3-4-9-14(13)24-2/h3-10,16,21H,1-2H3,(H,22,23) |
| InChIKey | VWGKWTGORZUVIE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.69 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|