C16H14Cl4N2O2 — CID 1381280
2-chloro-N-[(1S)-2,2,2-trichloro-1-(4-methoxyanilino)ethyl]benzamide (PubChem CID 1381280) has the molecular formula C16H14Cl4N2O2 and a molecular weight of 408.11 g/mol. Its IUPAC name is 2-chloro-N-[(1S)-2,2,2-trichloro-1-(4-methoxyanilino)ethyl]benzamide.
| Compound Name | 2-chloro-N-[(1S)-2,2,2-trichloro-1-(4-methoxyanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 1381280 |
| Molecular Formula | C16H14Cl4N2O2 |
| Molecular Weight | 408.11 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | 2-chloro-N-[(1S)-2,2,2-trichloro-1-(4-methoxyanilino)ethyl]benzamide |
| SMILES | COc1ccc(N[C@@H](NC(=O)c2ccccc2Cl)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H14Cl4N2O2/c1-24-11-8-6-10(7-9-11)21-15(16(18,19)20)22-14(23)12-4-2-3-5-13(12)17/h2-9,15,21H,1H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | YTQLYEZNPGYFNU-HNNXBMFYSA-N |
| XLogP | 4.89 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.11 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|