C17H16Cl4N2O3 — CID 2887409
3,4-dimethoxy-N-[2,2,2-trichloro-1-(4-chloroanilino)ethyl]benzamide (PubChem CID 2887409) has the molecular formula C17H16Cl4N2O3 and a molecular weight of 438.14 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2,2,2-trichloro-1-(4-chloroanilino)ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2,2,2-trichloro-1-(4-chloroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 2887409 |
| Molecular Formula | C17H16Cl4N2O3 |
| Molecular Weight | 438.14 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | 3,4-dimethoxy-N-[2,2,2-trichloro-1-(4-chloroanilino)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(Nc2ccc(Cl)cc2)C(Cl)(Cl)Cl)cc1OC |
| InChI | InChI=1S/C17H16Cl4N2O3/c1-25-13-8-3-10(9-14(13)26-2)15(24)23-16(17(19,20)21)22-12-6-4-11(18)5-7-12/h3-9,16,22H,1-2H3,(H,23,24) |
| InChIKey | WESKIWYHQZEKFY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.14 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|