C16H13Cl4N3O4 — CID 6548767
4-chloro-N-[(1R)-2,2,2-trichloro-1-(4-methoxy-3-nitroanilino)ethyl]benzamide (PubChem CID 6548767) has the molecular formula C16H13Cl4N3O4 and a molecular weight of 453.11 g/mol. Its IUPAC name is 4-chloro-N-[(1R)-2,2,2-trichloro-1-(4-methoxy-3-nitroanilino)ethyl]benzamide.
| Compound Name | 4-chloro-N-[(1R)-2,2,2-trichloro-1-(4-methoxy-3-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 6548767 |
| Molecular Formula | C16H13Cl4N3O4 |
| Molecular Weight | 453.11 g/mol |
| Exact Mass | 450.97 |
| IUPAC Name | 4-chloro-N-[(1R)-2,2,2-trichloro-1-(4-methoxy-3-nitroanilino)ethyl]benzamide |
| SMILES | COc1ccc(N[C@H](NC(=O)c2ccc(Cl)cc2)C(Cl)(Cl)Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13Cl4N3O4/c1-27-13-7-6-11(8-12(13)23(25)26)21-15(16(18,19)20)22-14(24)9-2-4-10(17)5-3-9/h2-8,15,21H,1H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | XEFMJFJTBDGMJD-OAHLLOKOSA-N |
| XLogP | 4.80 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.11 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|