C16H14BrCl3N2O — CID 27340129
N-[(1R)-1-(4-bromoanilino)-2,2,2-trichloroethyl]-3-methylbenzamide (PubChem CID 27340129) has the molecular formula C16H14BrCl3N2O and a molecular weight of 436.56 g/mol. Its IUPAC name is N-[(1R)-1-(4-bromoanilino)-2,2,2-trichloroethyl]-3-methylbenzamide.
| Compound Name | N-[(1R)-1-(4-bromoanilino)-2,2,2-trichloroethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 27340129 |
| Molecular Formula | C16H14BrCl3N2O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 433.94 |
| IUPAC Name | N-[(1R)-1-(4-bromoanilino)-2,2,2-trichloroethyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N[C@@H](Nc2ccc(Br)cc2)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C16H14BrCl3N2O/c1-10-3-2-4-11(9-10)14(23)22-15(16(18,19)20)21-13-7-5-12(17)6-8-13/h2-9,15,21H,1H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | QPQFRXJMDBBAPZ-OAHLLOKOSA-N |
| XLogP | 5.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|