C16H21Cl3N2O — CID 4231231
3-methyl-N-[2,2,2-trichloro-1-(cyclohexylamino)ethyl]benzamide (PubChem CID 4231231) has the molecular formula C16H21Cl3N2O and a molecular weight of 363.72 g/mol. Its IUPAC name is 3-methyl-N-[2,2,2-trichloro-1-(cyclohexylamino)ethyl]benzamide.
| Compound Name | 3-methyl-N-[2,2,2-trichloro-1-(cyclohexylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 4231231 |
| Molecular Formula | C16H21Cl3N2O |
| Molecular Weight | 363.72 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 3-methyl-N-[2,2,2-trichloro-1-(cyclohexylamino)ethyl]benzamide |
| SMILES | Cc1cccc(C(=O)NC(NC2CCCCC2)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C16H21Cl3N2O/c1-11-6-5-7-12(10-11)14(22)21-15(16(17,18)19)20-13-8-3-2-4-9-13/h5-7,10,13,15,20H,2-4,8-9H2,1H3,(H,21,22) |
| InChIKey | JULRPVNIQGAHCW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.72 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|