C18H22Cl3N3OS — CID 92837364
3-methyl-N-[(1S)-2,2,2-trichloro-1-(cycloheptylidenecarbamothioylamino)ethyl]benzamide (PubChem CID 92837364) has the molecular formula C18H22Cl3N3OS and a molecular weight of 434.82 g/mol. Its IUPAC name is 3-methyl-N-[(1S)-2,2,2-trichloro-1-(cycloheptylidenecarbamothioylamino)ethyl]benzamide.
| Compound Name | 3-methyl-N-[(1S)-2,2,2-trichloro-1-(cycloheptylidenecarbamothioylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 92837364 |
| Molecular Formula | C18H22Cl3N3OS |
| Molecular Weight | 434.82 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 3-methyl-N-[(1S)-2,2,2-trichloro-1-(cycloheptylidenecarbamothioylamino)ethyl]benzamide |
| SMILES | Cc1cccc(C(=O)N[C@@H](NC(=S)N=C2CCCCCC2)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C18H22Cl3N3OS/c1-12-7-6-8-13(11-12)15(25)23-16(18(19,20)21)24-17(26)22-14-9-4-2-3-5-10-14/h6-8,11,16H,2-5,9-10H2,1H3,(H,23,25)(H,24,26)/t16-/m0/s1 |
| InChIKey | ZTQKUTFMPHGORH-INIZCTEOSA-N |
| XLogP | 5.09 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.82 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|