C19H19Cl3N4O2S — CID 170860788
N-[1-[[4-(2-aminoacetyl)phenyl]carbamothioylamino]-2,2,2-trichloroethyl]-3-methylbenzamide (PubChem CID 170860788) has the molecular formula C19H19Cl3N4O2S and a molecular weight of 473.81 g/mol. Its IUPAC name is N-[1-[[4-(2-aminoacetyl)phenyl]carbamothioylamino]-2,2,2-trichloroethyl]-3-methylbenzamide.
| Compound Name | N-[1-[[4-(2-aminoacetyl)phenyl]carbamothioylamino]-2,2,2-trichloroethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 170860788 |
| Molecular Formula | C19H19Cl3N4O2S |
| Molecular Weight | 473.81 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | N-[1-[[4-(2-aminoacetyl)phenyl]carbamothioylamino]-2,2,2-trichloroethyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(NC(=S)Nc2ccc(C(=O)CN)cc2)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C19H19Cl3N4O2S/c1-11-3-2-4-13(9-11)16(28)25-17(19(20,21)22)26-18(29)24-14-7-5-12(6-8-14)15(27)10-23/h2-9,17H,10,23H2,1H3,(H,25,28)(H2,24,26,29) |
| InChIKey | QZUKGPHKWYGRGI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.81 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|