C17H15Cl3IN3OS — CID 4604378
3-iodo-N-[2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 4604378) has the molecular formula C17H15Cl3IN3OS and a molecular weight of 542.66 g/mol. Its IUPAC name is 3-iodo-N-[2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 3-iodo-N-[2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 4604378 |
| Molecular Formula | C17H15Cl3IN3OS |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 540.90 |
| IUPAC Name | 3-iodo-N-[2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | Cc1ccc(NC(=S)NC(NC(=O)c2cccc(I)c2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H15Cl3IN3OS/c1-10-5-7-13(8-6-10)22-16(26)24-15(17(18,19)20)23-14(25)11-3-2-4-12(21)9-11/h2-9,15H,1H3,(H,23,25)(H2,22,24,26) |
| InChIKey | NMUQWBHQILBVAB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|