C23H20Cl3N3OS — CID 2906186
4-methyl-N-[2,2,2-trichloro-1-[(4-phenylphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 2906186) has the molecular formula C23H20Cl3N3OS and a molecular weight of 492.86 g/mol. Its IUPAC name is 4-methyl-N-[2,2,2-trichloro-1-[(4-phenylphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 4-methyl-N-[2,2,2-trichloro-1-[(4-phenylphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 2906186 |
| Molecular Formula | C23H20Cl3N3OS |
| Molecular Weight | 492.86 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | 4-methyl-N-[2,2,2-trichloro-1-[(4-phenylphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(NC(=S)Nc2ccc(-c3ccccc3)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C23H20Cl3N3OS/c1-15-7-9-18(10-8-15)20(30)28-21(23(24,25)26)29-22(31)27-19-13-11-17(12-14-19)16-5-3-2-4-6-16/h2-14,21H,1H3,(H,28,30)(H2,27,29,31) |
| InChIKey | NHWWYYKCZSXUFG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.86 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|