C14H19Cl3N2O — CID 31725847
N-[(1R)-1-(butylamino)-2,2,2-trichloroethyl]-3-methylbenzamide (PubChem CID 31725847) has the molecular formula C14H19Cl3N2O and a molecular weight of 337.68 g/mol. Its IUPAC name is N-[(1R)-1-(butylamino)-2,2,2-trichloroethyl]-3-methylbenzamide.
| Compound Name | N-[(1R)-1-(butylamino)-2,2,2-trichloroethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 31725847 |
| Molecular Formula | C14H19Cl3N2O |
| Molecular Weight | 337.68 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-[(1R)-1-(butylamino)-2,2,2-trichloroethyl]-3-methylbenzamide |
| SMILES | CCCCN[C@H](NC(=O)c1cccc(C)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H19Cl3N2O/c1-3-4-8-18-13(14(15,16)17)19-12(20)11-7-5-6-10(2)9-11/h5-7,9,13,18H,3-4,8H2,1-2H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | MUPLFFQULYFMNT-CYBMUJFWSA-N |
| XLogP | 3.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.68 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|