C19H17Cl3N4OS — CID 18879589
3-methyl-N-[2,2,2-trichloro-1-[[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino]ethyl]benzamide (PubChem CID 18879589) has the molecular formula C19H17Cl3N4OS and a molecular weight of 455.80 g/mol. Its IUPAC name is 3-methyl-N-[2,2,2-trichloro-1-[[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino]ethyl]benzamide.
| Compound Name | 3-methyl-N-[2,2,2-trichloro-1-[[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 18879589 |
| Molecular Formula | C19H17Cl3N4OS |
| Molecular Weight | 455.80 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | 3-methyl-N-[2,2,2-trichloro-1-[[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino]ethyl]benzamide |
| SMILES | Cc1ccc(-c2nnc(NC(NC(=O)c3cccc(C)c3)C(Cl)(Cl)Cl)s2)cc1 |
| InChI | InChI=1S/C19H17Cl3N4OS/c1-11-6-8-13(9-7-11)16-25-26-18(28-16)24-17(19(20,21)22)23-15(27)14-5-3-4-12(2)10-14/h3-10,17H,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | LFPOKGYWVRZCDI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.80 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|