C19H27NO3 — CID 58700147
(2S)-5-cyclohexyl-2-[(3-methylbenzoyl)amino]pentanoic acid (PubChem CID 58700147) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (2S)-5-cyclohexyl-2-[(3-methylbenzoyl)amino]pentanoic acid.
| Compound Name | (2S)-5-cyclohexyl-2-[(3-methylbenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 58700147 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (2S)-5-cyclohexyl-2-[(3-methylbenzoyl)amino]pentanoic acid |
| SMILES | Cc1cccc(C(=O)N[C@@H](CCCC2CCCCC2)C(=O)O)c1 |
| InChI | InChI=1S/C19H27NO3/c1-14-7-5-11-16(13-14)18(21)20-17(19(22)23)12-6-10-15-8-3-2-4-9-15/h5,7,11,13,15,17H,2-4,6,8-10,12H2,1H3,(H,20,21)(H,22,23)/t17-/m0/s1 |
| InChIKey | VZSWJPVHIOBHSL-KRWDZBQOSA-N |
| XLogP | 3.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |