C16H12Cl4N2O4 — CID 1242923
1-[(2R)-5-chloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]-3-(4-methoxyphenyl)urea (PubChem CID 1242923) has the molecular formula C16H12Cl4N2O4 and a molecular weight of 438.09 g/mol. Its IUPAC name is 1-[(2R)-5-chloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[(2R)-5-chloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 1242923 |
| Molecular Formula | C16H12Cl4N2O4 |
| Molecular Weight | 438.09 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | 1-[(2R)-5-chloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N[C@]2(C(Cl)(Cl)Cl)Oc3ccc(Cl)cc3O2)cc1 |
| InChI | InChI=1S/C16H12Cl4N2O4/c1-24-11-5-3-10(4-6-11)21-14(23)22-16(15(18,19)20)25-12-7-2-9(17)8-13(12)26-16/h2-8H,1H3,(H2,21,22,23)/t16-/m1/s1 |
| InChIKey | MAPGTRRAVGUOLY-MRXNPFEDSA-N |
| XLogP | 4.97 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.09 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|