C16H8Cl2F4N2O3S — CID 12819197
2-chloro-N-[(3-chloro-2,2,3-trifluoro-1,4-benzodioxin-6-yl)carbamothioyl]-6-fluorobenzamide (PubChem CID 12819197) has the molecular formula C16H8Cl2F4N2O3S and a molecular weight of 455.22 g/mol. Its IUPAC name is 2-chloro-N-[(3-chloro-2,2,3-trifluoro-1,4-benzodioxin-6-yl)carbamothioyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[(3-chloro-2,2,3-trifluoro-1,4-benzodioxin-6-yl)carbamothioyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 12819197 |
| Molecular Formula | C16H8Cl2F4N2O3S |
| Molecular Weight | 455.22 g/mol |
| Exact Mass | 453.96 |
| IUPAC Name | 2-chloro-N-[(3-chloro-2,2,3-trifluoro-1,4-benzodioxin-6-yl)carbamothioyl]-6-fluorobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc2c(c1)OC(F)(Cl)C(F)(F)O2)c1c(F)cccc1Cl |
| InChI | InChI=1S/C16H8Cl2F4N2O3S/c17-8-2-1-3-9(19)12(8)13(25)24-14(28)23-7-4-5-10-11(6-7)26-15(18,20)16(21,22)27-10/h1-6H,(H2,23,24,25,28) |
| InChIKey | YZEWSRQSGXHOBP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.22 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|