C10H5Cl4FN2O2 — CID 2780073
2-chloro-6-fluoro-N-(1,2,2-trichloroethenylcarbamoyl)benzamide (PubChem CID 2780073) has the molecular formula C10H5Cl4FN2O2 and a molecular weight of 345.97 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-(1,2,2-trichloroethenylcarbamoyl)benzamide.
| Compound Name | 2-chloro-6-fluoro-N-(1,2,2-trichloroethenylcarbamoyl)benzamide |
|---|---|
| PubChem CID | 2780073 |
| Molecular Formula | C10H5Cl4FN2O2 |
| Molecular Weight | 345.97 g/mol |
| Exact Mass | 343.91 |
| IUPAC Name | 2-chloro-6-fluoro-N-(1,2,2-trichloroethenylcarbamoyl)benzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1Cl)NC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C10H5Cl4FN2O2/c11-4-2-1-3-5(15)6(4)9(18)17-10(19)16-8(14)7(12)13/h1-3H,(H2,16,17,18,19) |
| InChIKey | HLJSQTJIPIXGPS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.97 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|