C14H9ClFIN2O2 — CID 4052856
2-chloro-6-fluoro-N-[(2-iodophenyl)carbamoyl]benzamide (PubChem CID 4052856) has the molecular formula C14H9ClFIN2O2 and a molecular weight of 418.59 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[(2-iodophenyl)carbamoyl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[(2-iodophenyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 4052856 |
| Molecular Formula | C14H9ClFIN2O2 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 417.94 |
| IUPAC Name | 2-chloro-6-fluoro-N-[(2-iodophenyl)carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1Cl)Nc1ccccc1I |
| InChI | InChI=1S/C14H9ClFIN2O2/c15-8-4-3-5-9(16)12(8)13(20)19-14(21)18-11-7-2-1-6-10(11)17/h1-7H,(H2,18,19,20,21) |
| InChIKey | BQJSOSUEZDIXHL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|