C14H8F3IN2O2 — CID 15592636
2,6-difluoro-N-[(2-fluoro-4-iodophenyl)carbamoyl]benzamide (PubChem CID 15592636) has the molecular formula C14H8F3IN2O2 and a molecular weight of 420.13 g/mol. Its IUPAC name is 2,6-difluoro-N-[(2-fluoro-4-iodophenyl)carbamoyl]benzamide.
| Compound Name | 2,6-difluoro-N-[(2-fluoro-4-iodophenyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 15592636 |
| Molecular Formula | C14H8F3IN2O2 |
| Molecular Weight | 420.13 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | 2,6-difluoro-N-[(2-fluoro-4-iodophenyl)carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1ccc(I)cc1F |
| InChI | InChI=1S/C14H8F3IN2O2/c15-8-2-1-3-9(16)12(8)13(21)20-14(22)19-11-5-4-7(18)6-10(11)17/h1-6H,(H2,19,20,21,22) |
| InChIKey | MFBKWMILRWBESX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.13 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|