C17H8F10N2O2S — CID 23034816
2,6-difluoro-N-[[2-fluoro-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]carbamoyl]benzamide (PubChem CID 23034816) has the molecular formula C17H8F10N2O2S and a molecular weight of 494.31 g/mol. Its IUPAC name is 2,6-difluoro-N-[[2-fluoro-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]carbamoyl]benzamide.
| Compound Name | 2,6-difluoro-N-[[2-fluoro-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 23034816 |
| Molecular Formula | C17H8F10N2O2S |
| Molecular Weight | 494.31 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 2,6-difluoro-N-[[2-fluoro-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1ccc(SC(F)(F)C(F)(F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C17H8F10N2O2S/c18-8-2-1-3-9(19)12(8)13(30)29-14(31)28-11-5-4-7(6-10(11)20)32-17(26,27)15(21,22)16(23,24)25/h1-6H,(H2,28,29,30,31) |
| InChIKey | GSAZTNAZSWLDBD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.31 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|