C15H5F9N2O2S — CID 23034886
2,6-difluoro-N-[[2,3,5,6-tetrafluoro-4-(trifluoromethylsulfanyl)phenyl]carbamoyl]benzamide (PubChem CID 23034886) has the molecular formula C15H5F9N2O2S and a molecular weight of 448.27 g/mol. Its IUPAC name is 2,6-difluoro-N-[[2,3,5,6-tetrafluoro-4-(trifluoromethylsulfanyl)phenyl]carbamoyl]benzamide.
| Compound Name | 2,6-difluoro-N-[[2,3,5,6-tetrafluoro-4-(trifluoromethylsulfanyl)phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 23034886 |
| Molecular Formula | C15H5F9N2O2S |
| Molecular Weight | 448.27 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | 2,6-difluoro-N-[[2,3,5,6-tetrafluoro-4-(trifluoromethylsulfanyl)phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1c(F)c(F)c(SC(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C15H5F9N2O2S/c16-4-2-1-3-5(17)6(4)13(27)26-14(28)25-11-7(18)9(20)12(10(21)8(11)19)29-15(22,23)24/h1-3H,(H2,25,26,27,28) |
| InChIKey | ZFTYHVXNVOJWGR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.27 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|