(2,6-difluorobenzoyl)carbamic acid;hydrochloride

C8H6ClF2NO3 — CID 70544596

IUPAC(2,6-difluorobenzoyl)carbamic acid;hydrochloride
SMILESCl.O=C(O)NC(=O)c1c(F)cccc1F
InChIInChI=1S/C8H5F2NO3.ClH/c9-4-2-1-3-5(10)6(4)7(12)11-8(13)14;/h1-3H,(H,11,12)(H,13,14);1H
InChIKeyILLOFRDRNPUNQV-UHFFFAOYSA-N
MW237.59 g/mol
LogP1.79
Rot. Bonds1

About (2,6-difluorobenzoyl)carbamic acid;hydrochloride

(2,6-difluorobenzoyl)carbamic acid;hydrochloride (PubChem CID 70544596) has the molecular formula C8H6ClF2NO3 and a molecular weight of 237.59 g/mol. Its IUPAC name is (2,6-difluorobenzoyl)carbamic acid;hydrochloride.

Molecular Properties

Compound Name(2,6-difluorobenzoyl)carbamic acid;hydrochloride
PubChem CID70544596
Molecular FormulaC8H6ClF2NO3
Molecular Weight237.59 g/mol
Exact Mass237.00
IUPAC Name(2,6-difluorobenzoyl)carbamic acid;hydrochloride
SMILESCl.O=C(O)NC(=O)c1c(F)cccc1F
InChIInChI=1S/C8H5F2NO3.ClH/c9-4-2-1-3-5(10)6(4)7(12)11-8(13)14;/h1-3H,(H,11,12)(H,13,14);1H
InChIKeyILLOFRDRNPUNQV-UHFFFAOYSA-N
XLogP1.79
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.59
LogP ≤ 51.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2,6-difluorobenzoyl)carbamic acid;hydrochloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,6-difluorobenzoyl)carbamic acid;hydrochloride?
The IUPAC name of (2,6-difluorobenzoyl)carbamic acid;hydrochloride (CID 70544596) is (2,6-difluorobenzoyl)carbamic acid;hydrochloride.
What is the SMILES notation for (2,6-difluorobenzoyl)carbamic acid;hydrochloride?
The canonical SMILES for (2,6-difluorobenzoyl)carbamic acid;hydrochloride is Cl.O=C(O)NC(=O)c1c(F)cccc1F.
What is the InChIKey of (2,6-difluorobenzoyl)carbamic acid;hydrochloride?
The InChIKey is ILLOFRDRNPUNQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F2NO3.ClH/c9-4-2-1-3-5(10)6(4)7(12)11-8(13)14;/h1-3H,(H,11,12)(H,13,14);1H.
What are the key properties of (2,6-difluorobenzoyl)carbamic acid;hydrochloride?
(2,6-difluorobenzoyl)carbamic acid;hydrochloride has a molecular weight of 237.59 g/mol, XLogP of 1.79, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-difluorobenzoyl)carbamic acid;hydrochloride is sourced from PubChem (CID 70544596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).