C13H10F2N2OS — CID 142366791
2,6-difluoro-N'-phenylsulfanylbenzohydrazide (PubChem CID 142366791) has the molecular formula C13H10F2N2OS and a molecular weight of 280.30 g/mol. Its IUPAC name is 2,6-difluoro-N'-phenylsulfanylbenzohydrazide.
| Compound Name | 2,6-difluoro-N'-phenylsulfanylbenzohydrazide |
|---|---|
| PubChem CID | 142366791 |
| Molecular Formula | C13H10F2N2OS |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2,6-difluoro-N'-phenylsulfanylbenzohydrazide |
| SMILES | O=C(NNSc1ccccc1)c1c(F)cccc1F |
| InChI | InChI=1S/C13H10F2N2OS/c14-10-7-4-8-11(15)12(10)13(18)16-17-19-9-5-2-1-3-6-9/h1-8,17H,(H,16,18) |
| InChIKey | YWIWLBZRQIJZGU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|