About 3-ethoxy-N'-phenylsulfanylbenzohydrazide
3-ethoxy-N'-phenylsulfanylbenzohydrazide (PubChem CID 155393059) has the molecular formula C15H16N2O2S
and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-ethoxy-N'-phenylsulfanylbenzohydrazide.
Molecular Properties
| Compound Name | 3-ethoxy-N'-phenylsulfanylbenzohydrazide |
| PubChem CID | 155393059 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-ethoxy-N'-phenylsulfanylbenzohydrazide |
| SMILES | CCOc1cccc(C(=O)NNSc2ccccc2)c1 |
| InChI | InChI=1S/C15H16N2O2S/c1-2-19-13-8-6-7-12(11-13)15(18)16-17-20-14-9-4-3-5-10-14/h3-11,17H,2H2,1H3,(H,16,18) |
| InChIKey | JFJLBWUMAXWYBP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-N'-phenylsulfanylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-N'-phenylsulfanylbenzohydrazide?
The IUPAC name of 3-ethoxy-N'-phenylsulfanylbenzohydrazide (CID 155393059) is 3-ethoxy-N'-phenylsulfanylbenzohydrazide.
What is the SMILES notation for 3-ethoxy-N'-phenylsulfanylbenzohydrazide?
The canonical SMILES for 3-ethoxy-N'-phenylsulfanylbenzohydrazide is CCOc1cccc(C(=O)NNSc2ccccc2)c1.
What is the InChIKey of 3-ethoxy-N'-phenylsulfanylbenzohydrazide?
The InChIKey is JFJLBWUMAXWYBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2S/c1-2-19-13-8-6-7-12(11-13)15(18)16-17-20-14-9-4-3-5-10-14/h3-11,17H,2H2,1H3,(H,16,18).
What are the key properties of 3-ethoxy-N'-phenylsulfanylbenzohydrazide?
3-ethoxy-N'-phenylsulfanylbenzohydrazide has a molecular weight of 288.37 g/mol, XLogP of 3.03, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-N'-phenylsulfanylbenzohydrazide is sourced from PubChem (CID 155393059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).