C14H8ClF2NO3 — CID 10244966
N-(5-chloro-2-hydroxybenzoyl)-2,6-difluorobenzamide (PubChem CID 10244966) has the molecular formula C14H8ClF2NO3 and a molecular weight of 311.67 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxybenzoyl)-2,6-difluorobenzamide.
| Compound Name | N-(5-chloro-2-hydroxybenzoyl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 10244966 |
| Molecular Formula | C14H8ClF2NO3 |
| Molecular Weight | 311.67 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | N-(5-chloro-2-hydroxybenzoyl)-2,6-difluorobenzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H8ClF2NO3/c15-7-4-5-11(19)8(6-7)13(20)18-14(21)12-9(16)2-1-3-10(12)17/h1-6,19H,(H,18,20,21) |
| InChIKey | QRDGNOWQGSTALX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.67 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|