C15H10ClFO3 — CID 776185
1-(5-chloro-2-hydroxyphenyl)-3-(3-fluorophenyl)propane-1,3-dione (PubChem CID 776185) has the molecular formula C15H10ClFO3 and a molecular weight of 292.69 g/mol. Its IUPAC name is 1-(5-chloro-2-hydroxyphenyl)-3-(3-fluorophenyl)propane-1,3-dione.
| Compound Name | 1-(5-chloro-2-hydroxyphenyl)-3-(3-fluorophenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 776185 |
| Molecular Formula | C15H10ClFO3 |
| Molecular Weight | 292.69 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 1-(5-chloro-2-hydroxyphenyl)-3-(3-fluorophenyl)propane-1,3-dione |
| SMILES | O=C(CC(=O)c1cc(Cl)ccc1O)c1cccc(F)c1 |
| InChI | InChI=1S/C15H10ClFO3/c16-10-4-5-13(18)12(7-10)15(20)8-14(19)9-2-1-3-11(17)6-9/h1-7,18H,8H2 |
| InChIKey | IAYZJBXKYNHXMK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.69 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|